C28H33NO5 — CID 139926756
butyl 8-[(4-heptylbenzoyl)amino]-4-oxochromene-2-carboxylate (PubChem CID 139926756) has the molecular formula C28H33NO5 and a molecular weight of 463.57 g/mol. Its IUPAC name is butyl 8-[(4-heptylbenzoyl)amino]-4-oxochromene-2-carboxylate.
| Compound Name | butyl 8-[(4-heptylbenzoyl)amino]-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 139926756 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | butyl 8-[(4-heptylbenzoyl)amino]-4-oxochromene-2-carboxylate |
| SMILES | CCCCCCCc1ccc(C(=O)Nc2cccc3c(=O)cc(C(=O)OCCCC)oc23)cc1 |
| InChI | InChI=1S/C28H33NO5/c1-3-5-7-8-9-11-20-14-16-21(17-15-20)27(31)29-23-13-10-12-22-24(30)19-25(34-26(22)23)28(32)33-18-6-4-2/h10,12-17,19H,3-9,11,18H2,1-2H3,(H,29,31) |
| InChIKey | KLWBWMDVYOTLIU-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|