C24H25NO6 — CID 139926774
methyl 8-[(4-hexoxybenzoyl)amino]-4-oxochromene-2-carboxylate (PubChem CID 139926774) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is methyl 8-[(4-hexoxybenzoyl)amino]-4-oxochromene-2-carboxylate.
| Compound Name | methyl 8-[(4-hexoxybenzoyl)amino]-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 139926774 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | methyl 8-[(4-hexoxybenzoyl)amino]-4-oxochromene-2-carboxylate |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2cccc3c(=O)cc(C(=O)OC)oc23)cc1 |
| InChI | InChI=1S/C24H25NO6/c1-3-4-5-6-14-30-17-12-10-16(11-13-17)23(27)25-19-9-7-8-18-20(26)15-21(24(28)29-2)31-22(18)19/h7-13,15H,3-6,14H2,1-2H3,(H,25,27) |
| InChIKey | XFGCHINRJARMQQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|