C24H26N2O6 — CID 139926820
8-[(4-heptoxybenzoyl)amino]-N-hydroxy-4-oxochromene-2-carboxamide (PubChem CID 139926820) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is 8-[(4-heptoxybenzoyl)amino]-N-hydroxy-4-oxochromene-2-carboxamide.
| Compound Name | 8-[(4-heptoxybenzoyl)amino]-N-hydroxy-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 139926820 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 8-[(4-heptoxybenzoyl)amino]-N-hydroxy-4-oxochromene-2-carboxamide |
| SMILES | CCCCCCCOc1ccc(C(=O)Nc2cccc3c(=O)cc(C(=O)NO)oc23)cc1 |
| InChI | InChI=1S/C24H26N2O6/c1-2-3-4-5-6-14-31-17-12-10-16(11-13-17)23(28)25-19-9-7-8-18-20(27)15-21(24(29)26-30)32-22(18)19/h7-13,15,30H,2-6,14H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | UDTYTRSGYZXBEY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|