C25H27NO6 — CID 139926727
ethyl 8-[(4-hexoxybenzoyl)amino]-4-oxochromene-2-carboxylate (PubChem CID 139926727) has the molecular formula C25H27NO6 and a molecular weight of 437.49 g/mol. Its IUPAC name is ethyl 8-[(4-hexoxybenzoyl)amino]-4-oxochromene-2-carboxylate.
| Compound Name | ethyl 8-[(4-hexoxybenzoyl)amino]-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 139926727 |
| Molecular Formula | C25H27NO6 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | ethyl 8-[(4-hexoxybenzoyl)amino]-4-oxochromene-2-carboxylate |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2cccc3c(=O)cc(C(=O)OCC)oc23)cc1 |
| InChI | InChI=1S/C25H27NO6/c1-3-5-6-7-15-31-18-13-11-17(12-14-18)24(28)26-20-10-8-9-19-21(27)16-22(32-23(19)20)25(29)30-4-2/h8-14,16H,3-7,15H2,1-2H3,(H,26,28) |
| InChIKey | HLJIFCKDURHQSP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|