C28H33NO6 — CID 139926792
tert-butyl 8-[(4-heptoxybenzoyl)amino]-4-oxochromene-2-carboxylate (PubChem CID 139926792) has the molecular formula C28H33NO6 and a molecular weight of 479.57 g/mol. Its IUPAC name is tert-butyl 8-[(4-heptoxybenzoyl)amino]-4-oxochromene-2-carboxylate.
| Compound Name | tert-butyl 8-[(4-heptoxybenzoyl)amino]-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 139926792 |
| Molecular Formula | C28H33NO6 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | tert-butyl 8-[(4-heptoxybenzoyl)amino]-4-oxochromene-2-carboxylate |
| SMILES | CCCCCCCOc1ccc(C(=O)Nc2cccc3c(=O)cc(C(=O)OC(C)(C)C)oc23)cc1 |
| InChI | InChI=1S/C28H33NO6/c1-5-6-7-8-9-17-33-20-15-13-19(14-16-20)26(31)29-22-12-10-11-21-23(30)18-24(34-25(21)22)27(32)35-28(2,3)4/h10-16,18H,5-9,17H2,1-4H3,(H,29,31) |
| InChIKey | DVGFKKJJXHVXKE-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|