C26H26N6O3 — CID 19387973
4-(4-phenylbutoxy)-N-[2-(2H-tetrazol-5-yl)-3,4-dihydro-1,2-benzoxazin-8-yl]benzamide (PubChem CID 19387973) has the molecular formula C26H26N6O3 and a molecular weight of 470.53 g/mol. Its IUPAC name is 4-(4-phenylbutoxy)-N-[2-(2H-tetrazol-5-yl)-3,4-dihydro-1,2-benzoxazin-8-yl]benzamide.
| Compound Name | 4-(4-phenylbutoxy)-N-[2-(2H-tetrazol-5-yl)-3,4-dihydro-1,2-benzoxazin-8-yl]benzamide |
|---|---|
| PubChem CID | 19387973 |
| Molecular Formula | C26H26N6O3 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 4-(4-phenylbutoxy)-N-[2-(2H-tetrazol-5-yl)-3,4-dihydro-1,2-benzoxazin-8-yl]benzamide |
| SMILES | O=C(Nc1cccc2c1ON(c1nn[nH]n1)CC2)c1ccc(OCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H26N6O3/c33-25(21-12-14-22(15-13-21)34-18-5-4-9-19-7-2-1-3-8-19)27-23-11-6-10-20-16-17-32(35-24(20)23)26-28-30-31-29-26/h1-3,6-8,10-15H,4-5,9,16-18H2,(H,27,33)(H,28,29,30,31) |
| InChIKey | NZDABAMAZXUZBZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|