C34H41N3O8S — CID 23124619
4-[2-(tert-butylsulfonylcarbamoyl)-8-[[4-(4-phenylbutoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazin-4-yl]butanoic acid (PubChem CID 23124619) has the molecular formula C34H41N3O8S and a molecular weight of 651.78 g/mol. Its IUPAC name is 4-[2-(tert-butylsulfonylcarbamoyl)-8-[[4-(4-phenylbutoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazin-4-yl]butanoic acid.
| Compound Name | 4-[2-(tert-butylsulfonylcarbamoyl)-8-[[4-(4-phenylbutoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 23124619 |
| Molecular Formula | C34H41N3O8S |
| Molecular Weight | 651.78 g/mol |
| Exact Mass | 651.26 |
| IUPAC Name | 4-[2-(tert-butylsulfonylcarbamoyl)-8-[[4-(4-phenylbutoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazin-4-yl]butanoic acid |
| SMILES | CC(C)(C)S(=O)(=O)NC(=O)C1CN(CCCC(=O)O)c2cccc(NC(=O)c3ccc(OCCCCc4ccccc4)cc3)c2O1 |
| InChI | InChI=1S/C34H41N3O8S/c1-34(2,3)46(42,43)36-33(41)29-23-37(21-10-16-30(38)39)28-15-9-14-27(31(28)45-29)35-32(40)25-17-19-26(20-18-25)44-22-8-7-13-24-11-5-4-6-12-24/h4-6,9,11-12,14-15,17-20,29H,7-8,10,13,16,21-23H2,1-3H3,(H,35,40)(H,36,41)(H,38,39) |
| InChIKey | VCSBXEDDGHKBGG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 151.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.78 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|