C31H35NO6 — CID 11443758
4-(3-carboxypropyl)-8-[2-[4-(4-phenoxybutyl)phenyl]ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (PubChem CID 11443758) has the molecular formula C31H35NO6 and a molecular weight of 517.62 g/mol. Its IUPAC name is 4-(3-carboxypropyl)-8-[2-[4-(4-phenoxybutyl)phenyl]ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid.
| Compound Name | 4-(3-carboxypropyl)-8-[2-[4-(4-phenoxybutyl)phenyl]ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
|---|---|
| PubChem CID | 11443758 |
| Molecular Formula | C31H35NO6 |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 4-(3-carboxypropyl)-8-[2-[4-(4-phenoxybutyl)phenyl]ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
| SMILES | O=C(O)CCCN1CC(C(=O)O)Oc2c(CCc3ccc(CCCCOc4ccccc4)cc3)cccc21 |
| InChI | InChI=1S/C31H35NO6/c33-29(34)13-7-20-32-22-28(31(35)36)38-30-25(9-6-12-27(30)32)19-18-24-16-14-23(15-17-24)8-4-5-21-37-26-10-2-1-3-11-26/h1-3,6,9-12,14-17,28H,4-5,7-8,13,18-22H2,(H,33,34)(H,35,36) |
| InChIKey | PBHFHKGWGIKMPW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|