C37H38N2O7S — CID 68509299
4-[2-(benzenesulfonylcarbamoyl)-8-[2-[4-(4-phenylbutoxy)phenyl]ethenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]butanoic acid (PubChem CID 68509299) has the molecular formula C37H38N2O7S and a molecular weight of 654.79 g/mol. Its IUPAC name is 4-[2-(benzenesulfonylcarbamoyl)-8-[2-[4-(4-phenylbutoxy)phenyl]ethenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]butanoic acid.
| Compound Name | 4-[2-(benzenesulfonylcarbamoyl)-8-[2-[4-(4-phenylbutoxy)phenyl]ethenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 68509299 |
| Molecular Formula | C37H38N2O7S |
| Molecular Weight | 654.79 g/mol |
| Exact Mass | 654.24 |
| IUPAC Name | 4-[2-(benzenesulfonylcarbamoyl)-8-[2-[4-(4-phenylbutoxy)phenyl]ethenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]butanoic acid |
| SMILES | O=C(O)CCCN1CC(C(=O)NS(=O)(=O)c2ccccc2)Oc2c(C=Cc3ccc(OCCCCc4ccccc4)cc3)cccc21 |
| InChI | InChI=1S/C37H38N2O7S/c40-35(41)18-10-25-39-27-34(37(42)38-47(43,44)32-15-5-2-6-16-32)46-36-30(14-9-17-33(36)39)22-19-29-20-23-31(24-21-29)45-26-8-7-13-28-11-3-1-4-12-28/h1-6,9,11-12,14-17,19-24,34H,7-8,10,13,18,25-27H2,(H,38,42)(H,40,41) |
| InChIKey | HSDWRDLIUJQOIC-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.79 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|