C31H32ClNO7 — CID 68509780
4-(3-carboxypropyl)-8-[2-[4-[4-(2-chlorophenoxy)butoxy]phenyl]ethenyl]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (PubChem CID 68509780) has the molecular formula C31H32ClNO7 and a molecular weight of 566.05 g/mol. Its IUPAC name is 4-(3-carboxypropyl)-8-[2-[4-[4-(2-chlorophenoxy)butoxy]phenyl]ethenyl]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid.
| Compound Name | 4-(3-carboxypropyl)-8-[2-[4-[4-(2-chlorophenoxy)butoxy]phenyl]ethenyl]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
|---|---|
| PubChem CID | 68509780 |
| Molecular Formula | C31H32ClNO7 |
| Molecular Weight | 566.05 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | 4-(3-carboxypropyl)-8-[2-[4-[4-(2-chlorophenoxy)butoxy]phenyl]ethenyl]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
| SMILES | O=C(O)CCCN1CC(C(=O)O)Oc2c(C=Cc3ccc(OCCCCOc4ccccc4Cl)cc3)cccc21 |
| InChI | InChI=1S/C31H32ClNO7/c32-25-8-1-2-10-27(25)39-20-4-3-19-38-24-16-13-22(14-17-24)12-15-23-7-5-9-26-30(23)40-28(31(36)37)21-33(26)18-6-11-29(34)35/h1-2,5,7-10,12-17,28H,3-4,6,11,18-21H2,(H,34,35)(H,36,37) |
| InChIKey | GMGNELJZTDVKIH-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.05 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|