C31H36N2O6 — CID 90899571
4-(4-methoxy-4-oxobutyl)-8-[[4-(4-phenylbutoxy)phenyl]methylamino]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (PubChem CID 90899571) has the molecular formula C31H36N2O6 and a molecular weight of 532.64 g/mol. Its IUPAC name is 4-(4-methoxy-4-oxobutyl)-8-[[4-(4-phenylbutoxy)phenyl]methylamino]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid.
| Compound Name | 4-(4-methoxy-4-oxobutyl)-8-[[4-(4-phenylbutoxy)phenyl]methylamino]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
|---|---|
| PubChem CID | 90899571 |
| Molecular Formula | C31H36N2O6 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 4-(4-methoxy-4-oxobutyl)-8-[[4-(4-phenylbutoxy)phenyl]methylamino]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
| SMILES | COC(=O)CCCN1CC(C(=O)O)Oc2c(NCc3ccc(OCCCCc4ccccc4)cc3)cccc21 |
| InChI | InChI=1S/C31H36N2O6/c1-37-29(34)14-8-19-33-22-28(31(35)36)39-30-26(12-7-13-27(30)33)32-21-24-15-17-25(18-16-24)38-20-6-5-11-23-9-3-2-4-10-23/h2-4,7,9-10,12-13,15-18,28,32H,5-6,8,11,14,19-22H2,1H3,(H,35,36) |
| InChIKey | RIEGWXLRFOKJFF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|