C33H38N2O7 — CID 23124780
ethyl 4-(4-methoxy-4-oxobutyl)-8-[[4-(4-phenylbutoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazine-2-carboxylate (PubChem CID 23124780) has the molecular formula C33H38N2O7 and a molecular weight of 574.67 g/mol. Its IUPAC name is ethyl 4-(4-methoxy-4-oxobutyl)-8-[[4-(4-phenylbutoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazine-2-carboxylate.
| Compound Name | ethyl 4-(4-methoxy-4-oxobutyl)-8-[[4-(4-phenylbutoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazine-2-carboxylate |
|---|---|
| PubChem CID | 23124780 |
| Molecular Formula | C33H38N2O7 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | ethyl 4-(4-methoxy-4-oxobutyl)-8-[[4-(4-phenylbutoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazine-2-carboxylate |
| SMILES | CCOC(=O)C1CN(CCCC(=O)OC)c2cccc(NC(=O)c3ccc(OCCCCc4ccccc4)cc3)c2O1 |
| InChI | InChI=1S/C33H38N2O7/c1-3-40-33(38)29-23-35(21-10-16-30(36)39-2)28-15-9-14-27(31(28)42-29)34-32(37)25-17-19-26(20-18-25)41-22-8-7-13-24-11-5-4-6-12-24/h4-6,9,11-12,14-15,17-20,29H,3,7-8,10,13,16,21-23H2,1-2H3,(H,34,37) |
| InChIKey | WDGDHDLDNWQCQA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|