C29H30N2O8 — CID 23124776
4-(3-carboxypropyl)-8-[[4-(2-phenylmethoxyethoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (PubChem CID 23124776) has the molecular formula C29H30N2O8 and a molecular weight of 534.57 g/mol. Its IUPAC name is 4-(3-carboxypropyl)-8-[[4-(2-phenylmethoxyethoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid.
| Compound Name | 4-(3-carboxypropyl)-8-[[4-(2-phenylmethoxyethoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
|---|---|
| PubChem CID | 23124776 |
| Molecular Formula | C29H30N2O8 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 4-(3-carboxypropyl)-8-[[4-(2-phenylmethoxyethoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
| SMILES | O=C(O)CCCN1CC(C(=O)O)Oc2c(NC(=O)c3ccc(OCCOCc4ccccc4)cc3)cccc21 |
| InChI | InChI=1S/C29H30N2O8/c32-26(33)10-5-15-31-18-25(29(35)36)39-27-23(8-4-9-24(27)31)30-28(34)21-11-13-22(14-12-21)38-17-16-37-19-20-6-2-1-3-7-20/h1-4,6-9,11-14,25H,5,10,15-19H2,(H,30,34)(H,32,33)(H,35,36) |
| InChIKey | YOHUQRFLSNARPK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|