C32H34ClNO7 — CID 68509305
4-(3-carboxypropyl)-8-[2-[4-[4-(2-chloro-6-methylphenoxy)butoxy]phenyl]ethenyl]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (PubChem CID 68509305) has the molecular formula C32H34ClNO7 and a molecular weight of 580.08 g/mol. Its IUPAC name is 4-(3-carboxypropyl)-8-[2-[4-[4-(2-chloro-6-methylphenoxy)butoxy]phenyl]ethenyl]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid.
| Compound Name | 4-(3-carboxypropyl)-8-[2-[4-[4-(2-chloro-6-methylphenoxy)butoxy]phenyl]ethenyl]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
|---|---|
| PubChem CID | 68509305 |
| Molecular Formula | C32H34ClNO7 |
| Molecular Weight | 580.08 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | 4-(3-carboxypropyl)-8-[2-[4-[4-(2-chloro-6-methylphenoxy)butoxy]phenyl]ethenyl]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
| SMILES | Cc1cccc(Cl)c1OCCCCOc1ccc(C=Cc2cccc3c2OC(C(=O)O)CN3CCCC(=O)O)cc1 |
| InChI | InChI=1S/C32H34ClNO7/c1-22-7-4-9-26(33)30(22)40-20-3-2-19-39-25-16-13-23(14-17-25)12-15-24-8-5-10-27-31(24)41-28(32(37)38)21-34(27)18-6-11-29(35)36/h4-5,7-10,12-17,28H,2-3,6,11,18-21H2,1H3,(H,35,36)(H,37,38) |
| InChIKey | KSFVCLDODBCJGN-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.08 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|