C33H33Cl2NO6 — CID 68696774
4-[1-(carboxymethyl)-7-[(E)-2-[4-[4-(2,4-dichloro-6-methylphenoxy)butoxy]phenyl]ethenyl]indol-3-yl]butanoic acid (PubChem CID 68696774) has the molecular formula C33H33Cl2NO6 and a molecular weight of 610.53 g/mol. Its IUPAC name is 4-[1-(carboxymethyl)-7-[(E)-2-[4-[4-(2,4-dichloro-6-methylphenoxy)butoxy]phenyl]ethenyl]indol-3-yl]butanoic acid.
| Compound Name | 4-[1-(carboxymethyl)-7-[(E)-2-[4-[4-(2,4-dichloro-6-methylphenoxy)butoxy]phenyl]ethenyl]indol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 68696774 |
| Molecular Formula | C33H33Cl2NO6 |
| Molecular Weight | 610.53 g/mol |
| Exact Mass | 609.17 |
| IUPAC Name | 4-[1-(carboxymethyl)-7-[(E)-2-[4-[4-(2,4-dichloro-6-methylphenoxy)butoxy]phenyl]ethenyl]indol-3-yl]butanoic acid |
| SMILES | Cc1cc(Cl)cc(Cl)c1OCCCCOc1ccc(/C=C/c2cccc3c(CCCC(=O)O)cn(CC(=O)O)c23)cc1 |
| InChI | InChI=1S/C33H33Cl2NO6/c1-22-18-26(34)19-29(35)33(22)42-17-3-2-16-41-27-14-11-23(12-15-27)10-13-24-6-4-8-28-25(7-5-9-30(37)38)20-36(32(24)28)21-31(39)40/h4,6,8,10-15,18-20H,2-3,5,7,9,16-17,21H2,1H3,(H,37,38)(H,39,40)/b13-10+ |
| InChIKey | OOFMFVYBZBKOAA-JLHYYAGUSA-N |
| XLogP | 8.16 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.53 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|