C32H29F2NO6 — CID 68717171
4-[1-(carboxymethyl)-7-[(E)-2-[4-[(E)-4-(2,4-difluorophenoxy)but-2-enoxy]phenyl]ethenyl]indol-3-yl]butanoic acid (PubChem CID 68717171) has the molecular formula C32H29F2NO6 and a molecular weight of 561.58 g/mol. Its IUPAC name is 4-[1-(carboxymethyl)-7-[(E)-2-[4-[(E)-4-(2,4-difluorophenoxy)but-2-enoxy]phenyl]ethenyl]indol-3-yl]butanoic acid.
| Compound Name | 4-[1-(carboxymethyl)-7-[(E)-2-[4-[(E)-4-(2,4-difluorophenoxy)but-2-enoxy]phenyl]ethenyl]indol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 68717171 |
| Molecular Formula | C32H29F2NO6 |
| Molecular Weight | 561.58 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | 4-[1-(carboxymethyl)-7-[(E)-2-[4-[(E)-4-(2,4-difluorophenoxy)but-2-enoxy]phenyl]ethenyl]indol-3-yl]butanoic acid |
| SMILES | O=C(O)CCCc1cn(CC(=O)O)c2c(/C=C/c3ccc(OC/C=C/COc4ccc(F)cc4F)cc3)cccc12 |
| InChI | InChI=1S/C32H29F2NO6/c33-25-13-16-29(28(34)19-25)41-18-2-1-17-40-26-14-10-22(11-15-26)9-12-23-5-3-7-27-24(6-4-8-30(36)37)20-35(32(23)27)21-31(38)39/h1-3,5,7,9-16,19-20H,4,6,8,17-18,21H2,(H,36,37)(H,38,39)/b2-1+,12-9+ |
| InChIKey | DNGVLVPEPXJRIX-COXFVOGNSA-N |
| XLogP | 6.60 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.58 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|