C33H34F2N2O7S — CID 68692463
4-[7-[2-[4-[4-(2,3-difluorophenoxy)butoxy]phenyl]ethenyl]-1-[2-(methanesulfonamido)-2-oxoethyl]indol-3-yl]butanoic acid (PubChem CID 68692463) has the molecular formula C33H34F2N2O7S and a molecular weight of 640.71 g/mol. Its IUPAC name is 4-[7-[2-[4-[4-(2,3-difluorophenoxy)butoxy]phenyl]ethenyl]-1-[2-(methanesulfonamido)-2-oxoethyl]indol-3-yl]butanoic acid.
| Compound Name | 4-[7-[2-[4-[4-(2,3-difluorophenoxy)butoxy]phenyl]ethenyl]-1-[2-(methanesulfonamido)-2-oxoethyl]indol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 68692463 |
| Molecular Formula | C33H34F2N2O7S |
| Molecular Weight | 640.71 g/mol |
| Exact Mass | 640.21 |
| IUPAC Name | 4-[7-[2-[4-[4-(2,3-difluorophenoxy)butoxy]phenyl]ethenyl]-1-[2-(methanesulfonamido)-2-oxoethyl]indol-3-yl]butanoic acid |
| SMILES | CS(=O)(=O)NC(=O)Cn1cc(CCCC(=O)O)c2cccc(C=Cc3ccc(OCCCCOc4cccc(F)c4F)cc3)c21 |
| InChI | InChI=1S/C33H34F2N2O7S/c1-45(41,42)36-30(38)22-37-21-25(8-5-12-31(39)40)27-9-4-7-24(33(27)37)16-13-23-14-17-26(18-15-23)43-19-2-3-20-44-29-11-6-10-28(34)32(29)35/h4,6-7,9-11,13-18,21H,2-3,5,8,12,19-20,22H2,1H3,(H,36,38)(H,39,40) |
| InChIKey | JIZJEWOFIYGLLS-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.71 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|