C33H33F2NO6S — CID 69401900
4-[1-(carboxymethyl)-7-[2-[4-[4-(2,3-difluorophenoxy)butoxy]phenyl]ethenyl]-2-methylsulfanylindol-3-yl]butanoic acid (PubChem CID 69401900) has the molecular formula C33H33F2NO6S and a molecular weight of 609.69 g/mol. Its IUPAC name is 4-[1-(carboxymethyl)-7-[2-[4-[4-(2,3-difluorophenoxy)butoxy]phenyl]ethenyl]-2-methylsulfanylindol-3-yl]butanoic acid.
| Compound Name | 4-[1-(carboxymethyl)-7-[2-[4-[4-(2,3-difluorophenoxy)butoxy]phenyl]ethenyl]-2-methylsulfanylindol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 69401900 |
| Molecular Formula | C33H33F2NO6S |
| Molecular Weight | 609.69 g/mol |
| Exact Mass | 609.20 |
| IUPAC Name | 4-[1-(carboxymethyl)-7-[2-[4-[4-(2,3-difluorophenoxy)butoxy]phenyl]ethenyl]-2-methylsulfanylindol-3-yl]butanoic acid |
| SMILES | CSc1c(CCCC(=O)O)c2cccc(C=Cc3ccc(OCCCCOc4cccc(F)c4F)cc3)c2n1CC(=O)O |
| InChI | InChI=1S/C33H33F2NO6S/c1-43-33-26(9-5-12-29(37)38)25-8-4-7-23(32(25)36(33)21-30(39)40)16-13-22-14-17-24(18-15-22)41-19-2-3-20-42-28-11-6-10-27(34)31(28)35/h4,6-8,10-11,13-18H,2-3,5,9,12,19-21H2,1H3,(H,37,38)(H,39,40) |
| InChIKey | YXTFGSCIVAZOBJ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.69 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|