C33H33F2NO6 — CID 173479982
4-[1-(carboxymethyl)-4-fluoro-7-[2-[4-[4-(2-fluorophenoxy)butoxy]phenyl]ethenyl]-2-methylindol-3-yl]butanoic acid (PubChem CID 173479982) has the molecular formula C33H33F2NO6 and a molecular weight of 577.62 g/mol. Its IUPAC name is 4-[1-(carboxymethyl)-4-fluoro-7-[2-[4-[4-(2-fluorophenoxy)butoxy]phenyl]ethenyl]-2-methylindol-3-yl]butanoic acid.
| Compound Name | 4-[1-(carboxymethyl)-4-fluoro-7-[2-[4-[4-(2-fluorophenoxy)butoxy]phenyl]ethenyl]-2-methylindol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 173479982 |
| Molecular Formula | C33H33F2NO6 |
| Molecular Weight | 577.62 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | 4-[1-(carboxymethyl)-4-fluoro-7-[2-[4-[4-(2-fluorophenoxy)butoxy]phenyl]ethenyl]-2-methylindol-3-yl]butanoic acid |
| SMILES | Cc1c(CCCC(=O)O)c2c(F)ccc(C=Cc3ccc(OCCCCOc4ccccc4F)cc3)c2n1CC(=O)O |
| InChI | InChI=1S/C33H33F2NO6/c1-22-26(7-6-10-30(37)38)32-28(35)18-15-24(33(32)36(22)21-31(39)40)14-11-23-12-16-25(17-13-23)41-19-4-5-20-42-29-9-3-2-8-27(29)34/h2-3,8-9,11-18H,4-7,10,19-21H2,1H3,(H,37,38)(H,39,40) |
| InChIKey | CLZFWGMSTQRINY-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.62 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|