C35H36FNO6 — CID 68694901
2-[1-[[1-(carboxymethyl)-4-fluoro-2-methyl-7-[(E)-2-[4-(4-phenoxybutoxy)phenyl]ethenyl]indol-3-yl]methyl]cyclopropyl]acetic acid (PubChem CID 68694901) has the molecular formula C35H36FNO6 and a molecular weight of 585.67 g/mol. Its IUPAC name is 2-[1-[[1-(carboxymethyl)-4-fluoro-2-methyl-7-[(E)-2-[4-(4-phenoxybutoxy)phenyl]ethenyl]indol-3-yl]methyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[[1-(carboxymethyl)-4-fluoro-2-methyl-7-[(E)-2-[4-(4-phenoxybutoxy)phenyl]ethenyl]indol-3-yl]methyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 68694901 |
| Molecular Formula | C35H36FNO6 |
| Molecular Weight | 585.67 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | 2-[1-[[1-(carboxymethyl)-4-fluoro-2-methyl-7-[(E)-2-[4-(4-phenoxybutoxy)phenyl]ethenyl]indol-3-yl]methyl]cyclopropyl]acetic acid |
| SMILES | Cc1c(CC2(CC(=O)O)CC2)c2c(F)ccc(/C=C/c3ccc(OCCCCOc4ccccc4)cc3)c2n1CC(=O)O |
| InChI | InChI=1S/C35H36FNO6/c1-24-29(21-35(17-18-35)22-31(38)39)33-30(36)16-13-26(34(33)37(24)23-32(40)41)12-9-25-10-14-28(15-11-25)43-20-6-5-19-42-27-7-3-2-4-8-27/h2-4,7-16H,5-6,17-23H2,1H3,(H,38,39)(H,40,41)/b12-9+ |
| InChIKey | DOBXQECSFIJTLW-FMIVXFBMSA-N |
| XLogP | 7.38 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.67 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|