C33H31ClFNO6 — CID 68697128
4-[1-(carboxymethyl)-7-[(E)-2-[4-[(E)-4-(2-chloro-5-fluorophenoxy)but-2-enoxy]phenyl]ethenyl]-2-methylindol-3-yl]butanoic acid (PubChem CID 68697128) has the molecular formula C33H31ClFNO6 and a molecular weight of 592.06 g/mol. Its IUPAC name is 4-[1-(carboxymethyl)-7-[(E)-2-[4-[(E)-4-(2-chloro-5-fluorophenoxy)but-2-enoxy]phenyl]ethenyl]-2-methylindol-3-yl]butanoic acid.
| Compound Name | 4-[1-(carboxymethyl)-7-[(E)-2-[4-[(E)-4-(2-chloro-5-fluorophenoxy)but-2-enoxy]phenyl]ethenyl]-2-methylindol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 68697128 |
| Molecular Formula | C33H31ClFNO6 |
| Molecular Weight | 592.06 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | 4-[1-(carboxymethyl)-7-[(E)-2-[4-[(E)-4-(2-chloro-5-fluorophenoxy)but-2-enoxy]phenyl]ethenyl]-2-methylindol-3-yl]butanoic acid |
| SMILES | Cc1c(CCCC(=O)O)c2cccc(/C=C/c3ccc(OC/C=C/COc4cc(F)ccc4Cl)cc3)c2n1CC(=O)O |
| InChI | InChI=1S/C33H31ClFNO6/c1-22-27(7-5-9-31(37)38)28-8-4-6-24(33(28)36(22)21-32(39)40)13-10-23-11-15-26(16-12-23)41-18-2-3-19-42-30-20-25(35)14-17-29(30)34/h2-4,6,8,10-17,20H,5,7,9,18-19,21H2,1H3,(H,37,38)(H,39,40)/b3-2+,13-10+ |
| InChIKey | GSFGZSDBRZMMNH-XEUDAOTRSA-N |
| XLogP | 7.42 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.06 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|