C34H35NO6 — CID 68696274
4-[1-(carboxymethyl)-2-methyl-7-[2-[4-[4-(2-methylphenoxy)but-2-enoxy]phenyl]ethenyl]indol-3-yl]butanoic acid (PubChem CID 68696274) has the molecular formula C34H35NO6 and a molecular weight of 553.66 g/mol. Its IUPAC name is 4-[1-(carboxymethyl)-2-methyl-7-[2-[4-[4-(2-methylphenoxy)but-2-enoxy]phenyl]ethenyl]indol-3-yl]butanoic acid.
| Compound Name | 4-[1-(carboxymethyl)-2-methyl-7-[2-[4-[4-(2-methylphenoxy)but-2-enoxy]phenyl]ethenyl]indol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 68696274 |
| Molecular Formula | C34H35NO6 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | 4-[1-(carboxymethyl)-2-methyl-7-[2-[4-[4-(2-methylphenoxy)but-2-enoxy]phenyl]ethenyl]indol-3-yl]butanoic acid |
| SMILES | Cc1ccccc1OCC=CCOc1ccc(C=Cc2cccc3c(CCCC(=O)O)c(C)n(CC(=O)O)c23)cc1 |
| InChI | InChI=1S/C34H35NO6/c1-24-9-3-4-13-31(24)41-22-6-5-21-40-28-19-16-26(17-20-28)15-18-27-10-7-12-30-29(11-8-14-32(36)37)25(2)35(34(27)30)23-33(38)39/h3-7,9-10,12-13,15-20H,8,11,14,21-23H2,1-2H3,(H,36,37)(H,38,39) |
| InChIKey | ZBLSIFLPXYZEPY-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|