C29H33NO6 — CID 66739197
ethyl 4-[7-[2-(4-acetyloxyphenyl)ethenyl]-1-(2-ethoxy-2-oxoethyl)-2-methylindol-3-yl]butanoate (PubChem CID 66739197) has the molecular formula C29H33NO6 and a molecular weight of 491.58 g/mol. Its IUPAC name is ethyl 4-[7-[2-(4-acetyloxyphenyl)ethenyl]-1-(2-ethoxy-2-oxoethyl)-2-methylindol-3-yl]butanoate.
| Compound Name | ethyl 4-[7-[2-(4-acetyloxyphenyl)ethenyl]-1-(2-ethoxy-2-oxoethyl)-2-methylindol-3-yl]butanoate |
|---|---|
| PubChem CID | 66739197 |
| Molecular Formula | C29H33NO6 |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | ethyl 4-[7-[2-(4-acetyloxyphenyl)ethenyl]-1-(2-ethoxy-2-oxoethyl)-2-methylindol-3-yl]butanoate |
| SMILES | CCOC(=O)CCCc1c(C)n(CC(=O)OCC)c2c(C=Cc3ccc(OC(C)=O)cc3)cccc12 |
| InChI | InChI=1S/C29H33NO6/c1-5-34-27(32)12-8-10-25-20(3)30(19-28(33)35-6-2)29-23(9-7-11-26(25)29)16-13-22-14-17-24(18-15-22)36-21(4)31/h7,9,11,13-18H,5-6,8,10,12,19H2,1-4H3 |
| InChIKey | HFDPQDWAROIPBX-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|