C36H38FNO5 — CID 66739104
2-[1-[[1-(carboxymethyl)-7-[2-[4-[4-(3-fluoro-2-methylphenyl)butoxy]phenyl]ethenyl]-2-methylindol-3-yl]methyl]cyclopropyl]acetic acid (PubChem CID 66739104) has the molecular formula C36H38FNO5 and a molecular weight of 583.70 g/mol. Its IUPAC name is 2-[1-[[1-(carboxymethyl)-7-[2-[4-[4-(3-fluoro-2-methylphenyl)butoxy]phenyl]ethenyl]-2-methylindol-3-yl]methyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[[1-(carboxymethyl)-7-[2-[4-[4-(3-fluoro-2-methylphenyl)butoxy]phenyl]ethenyl]-2-methylindol-3-yl]methyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 66739104 |
| Molecular Formula | C36H38FNO5 |
| Molecular Weight | 583.70 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | 2-[1-[[1-(carboxymethyl)-7-[2-[4-[4-(3-fluoro-2-methylphenyl)butoxy]phenyl]ethenyl]-2-methylindol-3-yl]methyl]cyclopropyl]acetic acid |
| SMILES | Cc1c(F)cccc1CCCCOc1ccc(C=Cc2cccc3c(CC4(CC(=O)O)CC4)c(C)n(CC(=O)O)c23)cc1 |
| InChI | InChI=1S/C36H38FNO5/c1-24-27(8-6-11-32(24)37)7-3-4-20-43-29-16-13-26(14-17-29)12-15-28-9-5-10-30-31(21-36(18-19-36)22-33(39)40)25(2)38(35(28)30)23-34(41)42/h5-6,8-17H,3-4,7,18-23H2,1-2H3,(H,39,40)(H,41,42) |
| InChIKey | KOWPGWCDGFTSCX-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.70 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|