C38H40FNO5 — CID 66738916
4-[1-[[1-(carboxymethyl)cyclopropyl]methyl]-7-[2-[4-[4-(3-fluoro-2-methylphenyl)butoxy]phenyl]ethynyl]-2-methylindol-3-yl]butanoic acid (PubChem CID 66738916) has the molecular formula C38H40FNO5 and a molecular weight of 609.74 g/mol. Its IUPAC name is 4-[1-[[1-(carboxymethyl)cyclopropyl]methyl]-7-[2-[4-[4-(3-fluoro-2-methylphenyl)butoxy]phenyl]ethynyl]-2-methylindol-3-yl]butanoic acid.
| Compound Name | 4-[1-[[1-(carboxymethyl)cyclopropyl]methyl]-7-[2-[4-[4-(3-fluoro-2-methylphenyl)butoxy]phenyl]ethynyl]-2-methylindol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 66738916 |
| Molecular Formula | C38H40FNO5 |
| Molecular Weight | 609.74 g/mol |
| Exact Mass | 609.29 |
| IUPAC Name | 4-[1-[[1-(carboxymethyl)cyclopropyl]methyl]-7-[2-[4-[4-(3-fluoro-2-methylphenyl)butoxy]phenyl]ethynyl]-2-methylindol-3-yl]butanoic acid |
| SMILES | Cc1c(F)cccc1CCCCOc1ccc(C#Cc2cccc3c(CCCC(=O)O)c(C)n(CC4(CC(=O)O)CC4)c23)cc1 |
| InChI | InChI=1S/C38H40FNO5/c1-26-29(9-6-13-34(26)39)8-3-4-23-45-31-19-16-28(17-20-31)15-18-30-10-5-12-33-32(11-7-14-35(41)42)27(2)40(37(30)33)25-38(21-22-38)24-36(43)44/h5-6,9-10,12-13,16-17,19-20H,3-4,7-8,11,14,21-25H2,1-2H3,(H,41,42)(H,43,44) |
| InChIKey | ZITKCQXWRLMERJ-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.74 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|