C19H21NO4 — CID 152770904
4-[1-(3-carboxypropyl)-7-ethynyl-2-methylindol-3-yl]butanoic acid (PubChem CID 152770904) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-[1-(3-carboxypropyl)-7-ethynyl-2-methylindol-3-yl]butanoic acid.
| Compound Name | 4-[1-(3-carboxypropyl)-7-ethynyl-2-methylindol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 152770904 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 4-[1-(3-carboxypropyl)-7-ethynyl-2-methylindol-3-yl]butanoic acid |
| SMILES | C#Cc1cccc2c(CCCC(=O)O)c(C)n(CCCC(=O)O)c12 |
| InChI | InChI=1S/C19H21NO4/c1-3-14-7-4-9-16-15(8-5-10-17(21)22)13(2)20(19(14)16)12-6-11-18(23)24/h1,4,7,9H,5-6,8,10-12H2,2H3,(H,21,22)(H,23,24) |
| InChIKey | JIQGRTIGSVIDBS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|