C47H60F5N5O9 — CID 173013606
4-[1-(3-carboxypropyl)-2-methyl-7-[2-[4-[4-(2,3,4,5,6-pentafluorophenyl)butoxy]phenyl]ethynyl]indol-3-yl]butanoic acid;bis(2,6-diaminohexanoic acid) (PubChem CID 173013606) has the molecular formula C47H60F5N5O9 and a molecular weight of 934.01 g/mol. Its IUPAC name is 4-[1-(3-carboxypropyl)-2-methyl-7-[2-[4-[4-(2,3,4,5,6-pentafluorophenyl)butoxy]phenyl]ethynyl]indol-3-yl]butanoic acid;bis(2,6-diaminohexanoic acid).
| Compound Name | 4-[1-(3-carboxypropyl)-2-methyl-7-[2-[4-[4-(2,3,4,5,6-pentafluorophenyl)butoxy]phenyl]ethynyl]indol-3-yl]butanoic acid;bis(2,6-diaminohexanoic acid) |
|---|---|
| PubChem CID | 173013606 |
| Molecular Formula | C47H60F5N5O9 |
| Molecular Weight | 934.01 g/mol |
| Exact Mass | 933.43 |
| IUPAC Name | 4-[1-(3-carboxypropyl)-2-methyl-7-[2-[4-[4-(2,3,4,5,6-pentafluorophenyl)butoxy]phenyl]ethynyl]indol-3-yl]butanoic acid;bis(2,6-diaminohexanoic acid) |
| SMILES | Cc1c(CCCC(=O)O)c2cccc(C#Cc3ccc(OCCCCc4c(F)c(F)c(F)c(F)c4F)cc3)c2n1CCCC(=O)O.NCCCCC(N)C(=O)O.NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C35H32F5NO5.2C6H14N2O2/c1-21-25(9-5-11-28(42)43)26-10-4-7-23(35(26)41(21)19-6-12-29(44)45)16-13-22-14-17-24(18-15-22)46-20-3-2-8-27-30(36)32(38)34(40)33(39)31(27)37;2*7-4-2-1-3-5(8)6(9)10/h4,7,10,14-15,17-18H,2-3,5-6,8-9,11-12,19-20H2,1H3,(H,42,43)(H,44,45);2*5H,1-4,7-8H2,(H,9,10) |
| InChIKey | AHTNGUYQXLCKBC-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 267.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.01 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|