C32H31NO7 — CID 66738677
4-[1-(carboxymethyl)-7-[2-[2-hydroxy-4-(4-phenoxybutoxy)phenyl]ethynyl]indol-3-yl]butanoic acid (PubChem CID 66738677) has the molecular formula C32H31NO7 and a molecular weight of 541.60 g/mol. Its IUPAC name is 4-[1-(carboxymethyl)-7-[2-[2-hydroxy-4-(4-phenoxybutoxy)phenyl]ethynyl]indol-3-yl]butanoic acid.
| Compound Name | 4-[1-(carboxymethyl)-7-[2-[2-hydroxy-4-(4-phenoxybutoxy)phenyl]ethynyl]indol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 66738677 |
| Molecular Formula | C32H31NO7 |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | 4-[1-(carboxymethyl)-7-[2-[2-hydroxy-4-(4-phenoxybutoxy)phenyl]ethynyl]indol-3-yl]butanoic acid |
| SMILES | O=C(O)CCCc1cn(CC(=O)O)c2c(C#Cc3ccc(OCCCCOc4ccccc4)cc3O)cccc12 |
| InChI | InChI=1S/C32H31NO7/c34-29-20-27(40-19-5-4-18-39-26-10-2-1-3-11-26)17-16-23(29)14-15-24-8-6-12-28-25(9-7-13-30(35)36)21-33(32(24)28)22-31(37)38/h1-3,6,8,10-12,16-17,20-21,34H,4-5,7,9,13,18-19,22H2,(H,35,36)(H,37,38) |
| InChIKey | MUVJVHOURFYZEF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|