C33H32N2O6S — CID 68690121
4-[1-(carboxymethyl)-7-[(E)-2-[6-(4-phenoxybutoxy)-1,3-benzothiazol-2-yl]ethenyl]indol-3-yl]butanoic acid (PubChem CID 68690121) has the molecular formula C33H32N2O6S and a molecular weight of 584.69 g/mol. Its IUPAC name is 4-[1-(carboxymethyl)-7-[(E)-2-[6-(4-phenoxybutoxy)-1,3-benzothiazol-2-yl]ethenyl]indol-3-yl]butanoic acid.
| Compound Name | 4-[1-(carboxymethyl)-7-[(E)-2-[6-(4-phenoxybutoxy)-1,3-benzothiazol-2-yl]ethenyl]indol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 68690121 |
| Molecular Formula | C33H32N2O6S |
| Molecular Weight | 584.69 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | 4-[1-(carboxymethyl)-7-[(E)-2-[6-(4-phenoxybutoxy)-1,3-benzothiazol-2-yl]ethenyl]indol-3-yl]butanoic acid |
| SMILES | O=C(O)CCCc1cn(CC(=O)O)c2c(/C=C/c3nc4ccc(OCCCCOc5ccccc5)cc4s3)cccc12 |
| InChI | InChI=1S/C33H32N2O6S/c36-31(37)13-7-9-24-21-35(22-32(38)39)33-23(8-6-12-27(24)33)14-17-30-34-28-16-15-26(20-29(28)42-30)41-19-5-4-18-40-25-10-2-1-3-11-25/h1-3,6,8,10-12,14-17,20-21H,4-5,7,9,13,18-19,22H2,(H,36,37)(H,38,39)/b17-14+ |
| InChIKey | LJIQVVPMQWHAHR-SAPNQHFASA-N |
| XLogP | 7.15 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.69 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|