C36H41NO6 — CID 69377725
4-[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-7-[2-[4-(4-phenoxybutoxy)phenyl]ethenyl]indol-3-yl]butanoic acid (PubChem CID 69377725) has the molecular formula C36H41NO6 and a molecular weight of 583.73 g/mol. Its IUPAC name is 4-[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-7-[2-[4-(4-phenoxybutoxy)phenyl]ethenyl]indol-3-yl]butanoic acid.
| Compound Name | 4-[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-7-[2-[4-(4-phenoxybutoxy)phenyl]ethenyl]indol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 69377725 |
| Molecular Formula | C36H41NO6 |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | 4-[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-7-[2-[4-(4-phenoxybutoxy)phenyl]ethenyl]indol-3-yl]butanoic acid |
| SMILES | CC(C)(C)OC(=O)Cn1cc(CCCC(=O)O)c2cccc(C=Cc3ccc(OCCCCOc4ccccc4)cc3)c21 |
| InChI | InChI=1S/C36H41NO6/c1-36(2,3)43-34(40)26-37-25-29(12-10-16-33(38)39)32-15-9-11-28(35(32)37)20-17-27-18-21-31(22-19-27)42-24-8-7-23-41-30-13-5-4-6-14-30/h4-6,9,11,13-15,17-22,25H,7-8,10,12,16,23-24,26H2,1-3H3,(H,38,39) |
| InChIKey | TUELEEWLDKOAAH-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|