C30H29NO6S — CID 69380251
2-[3-(carboxymethylsulfanyl)-7-[2-[4-(4-phenoxybutoxy)phenyl]ethenyl]indol-1-yl]acetic acid (PubChem CID 69380251) has the molecular formula C30H29NO6S and a molecular weight of 531.63 g/mol. Its IUPAC name is 2-[3-(carboxymethylsulfanyl)-7-[2-[4-(4-phenoxybutoxy)phenyl]ethenyl]indol-1-yl]acetic acid.
| Compound Name | 2-[3-(carboxymethylsulfanyl)-7-[2-[4-(4-phenoxybutoxy)phenyl]ethenyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 69380251 |
| Molecular Formula | C30H29NO6S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | 2-[3-(carboxymethylsulfanyl)-7-[2-[4-(4-phenoxybutoxy)phenyl]ethenyl]indol-1-yl]acetic acid |
| SMILES | O=C(O)CSc1cn(CC(=O)O)c2c(C=Cc3ccc(OCCCCOc4ccccc4)cc3)cccc12 |
| InChI | InChI=1S/C30H29NO6S/c32-28(33)20-31-19-27(38-21-29(34)35)26-10-6-7-23(30(26)31)14-11-22-12-15-25(16-13-22)37-18-5-4-17-36-24-8-2-1-3-9-24/h1-3,6-16,19H,4-5,17-18,20-21H2,(H,32,33)(H,34,35) |
| InChIKey | KLFPVMGLQYMQGU-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|