C34H33NO6 — CID 69378898
4-[1-(carboxymethyl)-7-[(E)-2-[4-[3-(2,3-dihydro-1H-inden-2-yl)propoxy]phenyl]ethenyl]indol-3-yl]-4-oxobutanoic acid (PubChem CID 69378898) has the molecular formula C34H33NO6 and a molecular weight of 551.64 g/mol. Its IUPAC name is 4-[1-(carboxymethyl)-7-[(E)-2-[4-[3-(2,3-dihydro-1H-inden-2-yl)propoxy]phenyl]ethenyl]indol-3-yl]-4-oxobutanoic acid.
| Compound Name | 4-[1-(carboxymethyl)-7-[(E)-2-[4-[3-(2,3-dihydro-1H-inden-2-yl)propoxy]phenyl]ethenyl]indol-3-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 69378898 |
| Molecular Formula | C34H33NO6 |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | 4-[1-(carboxymethyl)-7-[(E)-2-[4-[3-(2,3-dihydro-1H-inden-2-yl)propoxy]phenyl]ethenyl]indol-3-yl]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)c1cn(CC(=O)O)c2c(/C=C/c3ccc(OCCCC4Cc5ccccc5C4)cc3)cccc12 |
| InChI | InChI=1S/C34H33NO6/c36-31(16-17-32(37)38)30-21-35(22-33(39)40)34-25(8-3-9-29(30)34)13-10-23-11-14-28(15-12-23)41-18-4-5-24-19-26-6-1-2-7-27(26)20-24/h1-3,6-15,21,24H,4-5,16-20,22H2,(H,37,38)(H,39,40)/b13-10+ |
| InChIKey | IEMPZVALBPWVIG-JLHYYAGUSA-N |
| XLogP | 6.52 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|