C34H35F2NO6 — CID 69380599
2-[7-[(E)-2-[4-[4-(2,3-difluorophenoxy)butoxy]phenyl]ethenyl]-3-(4-ethoxy-4-oxobutyl)indol-1-yl]acetic acid (PubChem CID 69380599) has the molecular formula C34H35F2NO6 and a molecular weight of 591.65 g/mol. Its IUPAC name is 2-[7-[(E)-2-[4-[4-(2,3-difluorophenoxy)butoxy]phenyl]ethenyl]-3-(4-ethoxy-4-oxobutyl)indol-1-yl]acetic acid.
| Compound Name | 2-[7-[(E)-2-[4-[4-(2,3-difluorophenoxy)butoxy]phenyl]ethenyl]-3-(4-ethoxy-4-oxobutyl)indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 69380599 |
| Molecular Formula | C34H35F2NO6 |
| Molecular Weight | 591.65 g/mol |
| Exact Mass | 591.24 |
| IUPAC Name | 2-[7-[(E)-2-[4-[4-(2,3-difluorophenoxy)butoxy]phenyl]ethenyl]-3-(4-ethoxy-4-oxobutyl)indol-1-yl]acetic acid |
| SMILES | CCOC(=O)CCCc1cn(CC(=O)O)c2c(/C=C/c3ccc(OCCCCOc4cccc(F)c4F)cc3)cccc12 |
| InChI | InChI=1S/C34H35F2NO6/c1-2-41-32(40)13-6-9-26-22-37(23-31(38)39)34-25(8-5-10-28(26)34)17-14-24-15-18-27(19-16-24)42-20-3-4-21-43-30-12-7-11-29(35)33(30)36/h5,7-8,10-12,14-19,22H,2-4,6,9,13,20-21,23H2,1H3,(H,38,39)/b17-14+ |
| InChIKey | BLSLNADASQMGJA-SAPNQHFASA-N |
| XLogP | 7.30 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.65 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|