C33H31F2NO6 — CID 173479996
4-[1-(1-carboxyethyl)-7-[2-[4-[(E)-4-(2,3-difluorophenoxy)but-2-enoxy]phenyl]ethenyl]indol-3-yl]butanoic acid (PubChem CID 173479996) has the molecular formula C33H31F2NO6 and a molecular weight of 575.61 g/mol. Its IUPAC name is 4-[1-(1-carboxyethyl)-7-[2-[4-[(E)-4-(2,3-difluorophenoxy)but-2-enoxy]phenyl]ethenyl]indol-3-yl]butanoic acid.
| Compound Name | 4-[1-(1-carboxyethyl)-7-[2-[4-[(E)-4-(2,3-difluorophenoxy)but-2-enoxy]phenyl]ethenyl]indol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 173479996 |
| Molecular Formula | C33H31F2NO6 |
| Molecular Weight | 575.61 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | 4-[1-(1-carboxyethyl)-7-[2-[4-[(E)-4-(2,3-difluorophenoxy)but-2-enoxy]phenyl]ethenyl]indol-3-yl]butanoic acid |
| SMILES | CC(C(=O)O)n1cc(CCCC(=O)O)c2cccc(C=Cc3ccc(OC/C=C/COc4cccc(F)c4F)cc3)c21 |
| InChI | InChI=1S/C33H31F2NO6/c1-22(33(39)40)36-21-25(8-5-12-30(37)38)27-9-4-7-24(32(27)36)16-13-23-14-17-26(18-15-23)41-19-2-3-20-42-29-11-6-10-28(34)31(29)35/h2-4,6-7,9-11,13-18,21-22H,5,8,12,19-20H2,1H3,(H,37,38)(H,39,40)/b3-2+,16-13? |
| InChIKey | FBUXPQVNDBGANW-ZCEFKAPZSA-N |
| XLogP | 7.16 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.61 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|