C32H32FNO6 — CID 68692888
4-[1-(carboxymethyl)-5-fluoro-7-[2-[4-(4-phenoxybutoxy)phenyl]ethenyl]indol-3-yl]butanoic acid (PubChem CID 68692888) has the molecular formula C32H32FNO6 and a molecular weight of 545.61 g/mol. Its IUPAC name is 4-[1-(carboxymethyl)-5-fluoro-7-[2-[4-(4-phenoxybutoxy)phenyl]ethenyl]indol-3-yl]butanoic acid.
| Compound Name | 4-[1-(carboxymethyl)-5-fluoro-7-[2-[4-(4-phenoxybutoxy)phenyl]ethenyl]indol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 68692888 |
| Molecular Formula | C32H32FNO6 |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | 4-[1-(carboxymethyl)-5-fluoro-7-[2-[4-(4-phenoxybutoxy)phenyl]ethenyl]indol-3-yl]butanoic acid |
| SMILES | O=C(O)CCCc1cn(CC(=O)O)c2c(C=Cc3ccc(OCCCCOc4ccccc4)cc3)cc(F)cc12 |
| InChI | InChI=1S/C32H32FNO6/c33-26-19-24(32-29(20-26)25(7-6-10-30(35)36)21-34(32)22-31(37)38)14-11-23-12-15-28(16-13-23)40-18-5-4-17-39-27-8-2-1-3-9-27/h1-3,8-9,11-16,19-21H,4-7,10,17-18,22H2,(H,35,36)(H,37,38) |
| InChIKey | WLFGZOSFZCQQTJ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|