C34H33NO8 — CID 68693954
4-[7-[2-[4-[4-(2-acetylphenoxy)butoxy]phenyl]ethenyl]-1-(carboxymethyl)indol-3-yl]-4-oxobutanoic acid (PubChem CID 68693954) has the molecular formula C34H33NO8 and a molecular weight of 583.64 g/mol. Its IUPAC name is 4-[7-[2-[4-[4-(2-acetylphenoxy)butoxy]phenyl]ethenyl]-1-(carboxymethyl)indol-3-yl]-4-oxobutanoic acid.
| Compound Name | 4-[7-[2-[4-[4-(2-acetylphenoxy)butoxy]phenyl]ethenyl]-1-(carboxymethyl)indol-3-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 68693954 |
| Molecular Formula | C34H33NO8 |
| Molecular Weight | 583.64 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | 4-[7-[2-[4-[4-(2-acetylphenoxy)butoxy]phenyl]ethenyl]-1-(carboxymethyl)indol-3-yl]-4-oxobutanoic acid |
| SMILES | CC(=O)c1ccccc1OCCCCOc1ccc(C=Cc2cccc3c(C(=O)CCC(=O)O)cn(CC(=O)O)c23)cc1 |
| InChI | InChI=1S/C34H33NO8/c1-23(36)27-8-2-3-10-31(27)43-20-5-4-19-42-26-15-12-24(13-16-26)11-14-25-7-6-9-28-29(30(37)17-18-32(38)39)21-35(34(25)28)22-33(40)41/h2-3,6-16,21H,4-5,17-20,22H2,1H3,(H,38,39)(H,40,41) |
| InChIKey | RRJWFMPXVLWCCN-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.64 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|