C37H34F5NO5 — CID 59378790
4-[1-[[1-(carboxymethyl)cyclopropyl]methyl]-2-methyl-7-[2-[4-[4-(2,3,4,5,6-pentafluorophenyl)butoxy]phenyl]ethynyl]indol-3-yl]butanoic acid (PubChem CID 59378790) has the molecular formula C37H34F5NO5 and a molecular weight of 667.67 g/mol. Its IUPAC name is 4-[1-[[1-(carboxymethyl)cyclopropyl]methyl]-2-methyl-7-[2-[4-[4-(2,3,4,5,6-pentafluorophenyl)butoxy]phenyl]ethynyl]indol-3-yl]butanoic acid.
| Compound Name | 4-[1-[[1-(carboxymethyl)cyclopropyl]methyl]-2-methyl-7-[2-[4-[4-(2,3,4,5,6-pentafluorophenyl)butoxy]phenyl]ethynyl]indol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 59378790 |
| Molecular Formula | C37H34F5NO5 |
| Molecular Weight | 667.67 g/mol |
| Exact Mass | 667.24 |
| IUPAC Name | 4-[1-[[1-(carboxymethyl)cyclopropyl]methyl]-2-methyl-7-[2-[4-[4-(2,3,4,5,6-pentafluorophenyl)butoxy]phenyl]ethynyl]indol-3-yl]butanoic acid |
| SMILES | Cc1c(CCCC(=O)O)c2cccc(C#Cc3ccc(OCCCCc4c(F)c(F)c(F)c(F)c4F)cc3)c2n1CC1(CC(=O)O)CC1 |
| InChI | InChI=1S/C37H34F5NO5/c1-22-26(8-5-10-29(44)45)27-9-4-6-24(36(27)43(22)21-37(17-18-37)20-30(46)47)14-11-23-12-15-25(16-13-23)48-19-3-2-7-28-31(38)33(40)35(42)34(41)32(28)39/h4,6,9,12-13,15-16H,2-3,5,7-8,10,17-21H2,1H3,(H,44,45)(H,46,47) |
| InChIKey | NKUAFBBOAGZFLJ-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.67 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|