C33H32F3NO6 — CID 68693233
4-[1-(carboxymethyl)-7-[2-[4-[4-(2,6-difluorophenoxy)butoxy]phenyl]ethenyl]-4-fluoro-2-methylindol-3-yl]butanoic acid (PubChem CID 68693233) has the molecular formula C33H32F3NO6 and a molecular weight of 595.61 g/mol. Its IUPAC name is 4-[1-(carboxymethyl)-7-[2-[4-[4-(2,6-difluorophenoxy)butoxy]phenyl]ethenyl]-4-fluoro-2-methylindol-3-yl]butanoic acid.
| Compound Name | 4-[1-(carboxymethyl)-7-[2-[4-[4-(2,6-difluorophenoxy)butoxy]phenyl]ethenyl]-4-fluoro-2-methylindol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 68693233 |
| Molecular Formula | C33H32F3NO6 |
| Molecular Weight | 595.61 g/mol |
| Exact Mass | 595.22 |
| IUPAC Name | 4-[1-(carboxymethyl)-7-[2-[4-[4-(2,6-difluorophenoxy)butoxy]phenyl]ethenyl]-4-fluoro-2-methylindol-3-yl]butanoic acid |
| SMILES | Cc1c(CCCC(=O)O)c2c(F)ccc(C=Cc3ccc(OCCCCOc4c(F)cccc4F)cc3)c2n1CC(=O)O |
| InChI | InChI=1S/C33H32F3NO6/c1-21-25(6-4-9-29(38)39)31-26(34)17-14-23(32(31)37(21)20-30(40)41)13-10-22-11-15-24(16-12-22)42-18-2-3-19-43-33-27(35)7-5-8-28(33)36/h5,7-8,10-17H,2-4,6,9,18-20H2,1H3,(H,38,39)(H,40,41) |
| InChIKey | AMUHPZSHKSEKRK-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.61 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|