2-amino-5-(1,3-dimethylisoindol-2-yl)pentanoic acid

C15H20N2O2 — CID 177368256

IUPAC2-amino-5-(1,3-dimethylisoindol-2-yl)pentanoic acid
SMILESCc1c2ccccc2c(C)n1CCCC(N)C(=O)O
InChIInChI=1S/C15H20N2O2/c1-10-12-6-3-4-7-13(12)11(2)17(10)9-5-8-14(16)15(18)19/h3-4,6-7,14H,5,8-9,16H2,1-2H3,(H,18,19)
InChIKeyFVIHSCVHWQIREF-UHFFFAOYSA-N
MW260.34 g/mol
LogP2.45
Rot. Bonds5

About 2-amino-5-(1,3-dimethylisoindol-2-yl)pentanoic acid

2-amino-5-(1,3-dimethylisoindol-2-yl)pentanoic acid (PubChem CID 177368256) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-amino-5-(1,3-dimethylisoindol-2-yl)pentanoic acid.

Molecular Properties

Compound Name2-amino-5-(1,3-dimethylisoindol-2-yl)pentanoic acid
PubChem CID177368256
Molecular FormulaC15H20N2O2
Molecular Weight260.34 g/mol
Exact Mass260.15
IUPAC Name2-amino-5-(1,3-dimethylisoindol-2-yl)pentanoic acid
SMILESCc1c2ccccc2c(C)n1CCCC(N)C(=O)O
InChIInChI=1S/C15H20N2O2/c1-10-12-6-3-4-7-13(12)11(2)17(10)9-5-8-14(16)15(18)19/h3-4,6-7,14H,5,8-9,16H2,1-2H3,(H,18,19)
InChIKeyFVIHSCVHWQIREF-UHFFFAOYSA-N
XLogP2.45
TPSA68.25 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.34
LogP ≤ 52.45
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-amino-5-(1,3-dimethylisoindol-2-yl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-5-(1,3-dimethylisoindol-2-yl)pentanoic acid?
The IUPAC name of 2-amino-5-(1,3-dimethylisoindol-2-yl)pentanoic acid (CID 177368256) is 2-amino-5-(1,3-dimethylisoindol-2-yl)pentanoic acid.
What is the SMILES notation for 2-amino-5-(1,3-dimethylisoindol-2-yl)pentanoic acid?
The canonical SMILES for 2-amino-5-(1,3-dimethylisoindol-2-yl)pentanoic acid is Cc1c2ccccc2c(C)n1CCCC(N)C(=O)O.
What is the InChIKey of 2-amino-5-(1,3-dimethylisoindol-2-yl)pentanoic acid?
The InChIKey is FVIHSCVHWQIREF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O2/c1-10-12-6-3-4-7-13(12)11(2)17(10)9-5-8-14(16)15(18)19/h3-4,6-7,14H,5,8-9,16H2,1-2H3,(H,18,19).
What are the key properties of 2-amino-5-(1,3-dimethylisoindol-2-yl)pentanoic acid?
2-amino-5-(1,3-dimethylisoindol-2-yl)pentanoic acid has a molecular weight of 260.34 g/mol, XLogP of 2.45, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-(1,3-dimethylisoindol-2-yl)pentanoic acid is sourced from PubChem (CID 177368256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).