C12H18N2O4 — CID 25205018
2-amino-6-(3-hydroxy-2-methyl-4-oxo-1-pyridinyl)hexanoic acid (PubChem CID 25205018) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-amino-6-(3-hydroxy-2-methyl-4-oxo-1-pyridinyl)hexanoic acid.
| Compound Name | 2-amino-6-(3-hydroxy-2-methyl-4-oxo-1-pyridinyl)hexanoic acid |
|---|---|
| PubChem CID | 25205018 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-amino-6-(3-hydroxy-2-methyl-4-oxo-1-pyridinyl)hexanoic acid |
| SMILES | Cc1c(O)c(=O)ccn1CCCCC(N)C(=O)O |
| InChI | InChI=1S/C12H18N2O4/c1-8-11(16)10(15)5-7-14(8)6-3-2-4-9(13)12(17)18/h5,7,9,16H,2-4,6,13H2,1H3,(H,17,18) |
| InChIKey | XREGTYIADDPJMA-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|