About bis(1-ethyl-3-hydroxy-2-methylpyridin-4-one);oxovanadium
bis(1-ethyl-3-hydroxy-2-methylpyridin-4-one);oxovanadium (PubChem CID 10883182) has the molecular formula C16H22N2O5V
and a molecular weight of 373.31 g/mol. Its IUPAC name is bis(1-ethyl-3-hydroxy-2-methylpyridin-4-one);oxovanadium.
Molecular Properties
| Compound Name | bis(1-ethyl-3-hydroxy-2-methylpyridin-4-one);oxovanadium |
| PubChem CID | 10883182 |
| Molecular Formula | C16H22N2O5V |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | bis(1-ethyl-3-hydroxy-2-methylpyridin-4-one);oxovanadium |
| SMILES | CCn1ccc(=O)c(O)c1C.CCn1ccc(=O)c(O)c1C.O=[V] |
| InChI | InChI=1S/2C8H11NO2.O.V/c2*1-3-9-5-4-7(10)8(11)6(9)2;;/h2*4-5,11H,3H2,1-2H3;; |
| InChIKey | FYDIEPVSGJHWPZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 101.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis(1-ethyl-3-hydroxy-2-methylpyridin-4-one);oxovanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-ethyl-3-hydroxy-2-methylpyridin-4-one);oxovanadium?
The IUPAC name of bis(1-ethyl-3-hydroxy-2-methylpyridin-4-one);oxovanadium (CID 10883182) is bis(1-ethyl-3-hydroxy-2-methylpyridin-4-one);oxovanadium.
What is the SMILES notation for bis(1-ethyl-3-hydroxy-2-methylpyridin-4-one);oxovanadium?
The canonical SMILES for bis(1-ethyl-3-hydroxy-2-methylpyridin-4-one);oxovanadium is CCn1ccc(=O)c(O)c1C.CCn1ccc(=O)c(O)c1C.O=[V].
What is the InChIKey of bis(1-ethyl-3-hydroxy-2-methylpyridin-4-one);oxovanadium?
The InChIKey is FYDIEPVSGJHWPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H11NO2.O.V/c2*1-3-9-5-4-7(10)8(11)6(9)2;;/h2*4-5,11H,3H2,1-2H3;;.
What are the key properties of bis(1-ethyl-3-hydroxy-2-methylpyridin-4-one);oxovanadium?
bis(1-ethyl-3-hydroxy-2-methylpyridin-4-one);oxovanadium has a molecular weight of 373.31 g/mol, XLogP of 1.64, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-ethyl-3-hydroxy-2-methylpyridin-4-one);oxovanadium is sourced from PubChem (CID 10883182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).