C13H20N2O4 — CID 91098436
1-(5-amino-7-hydroxy-6-oxoheptyl)-3-hydroxy-2-methylpyridin-4-one (PubChem CID 91098436) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-(5-amino-7-hydroxy-6-oxoheptyl)-3-hydroxy-2-methylpyridin-4-one.
| Compound Name | 1-(5-amino-7-hydroxy-6-oxoheptyl)-3-hydroxy-2-methylpyridin-4-one |
|---|---|
| PubChem CID | 91098436 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-(5-amino-7-hydroxy-6-oxoheptyl)-3-hydroxy-2-methylpyridin-4-one |
| SMILES | Cc1c(O)c(=O)ccn1CCCCC(N)C(=O)CO |
| InChI | InChI=1S/C13H20N2O4/c1-9-13(19)11(17)5-7-15(9)6-3-2-4-10(14)12(18)8-16/h5,7,10,16,19H,2-4,6,8,14H2,1H3 |
| InChIKey | KGGNCWQYHHMLBF-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|