C14H17NO2S — CID 126584285
3-(1,2-dimethyl-7-methylsulfanylindol-3-yl)propanoic acid (PubChem CID 126584285) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is 3-(1,2-dimethyl-7-methylsulfanylindol-3-yl)propanoic acid.
| Compound Name | 3-(1,2-dimethyl-7-methylsulfanylindol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 126584285 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 3-(1,2-dimethyl-7-methylsulfanylindol-3-yl)propanoic acid |
| SMILES | CSc1cccc2c(CCC(=O)O)c(C)n(C)c12 |
| InChI | InChI=1S/C14H17NO2S/c1-9-10(7-8-13(16)17)11-5-4-6-12(18-3)14(11)15(9)2/h4-6H,7-8H2,1-3H3,(H,16,17) |
| InChIKey | RIFBKUPGAXGTRH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|