C16H21NO — CID 82497423
4-(7-ethyl-1,2-dimethylindol-3-yl)butan-2-one (PubChem CID 82497423) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 4-(7-ethyl-1,2-dimethylindol-3-yl)butan-2-one.
| Compound Name | 4-(7-ethyl-1,2-dimethylindol-3-yl)butan-2-one |
|---|---|
| PubChem CID | 82497423 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 4-(7-ethyl-1,2-dimethylindol-3-yl)butan-2-one |
| SMILES | CCc1cccc2c(CCC(C)=O)c(C)n(C)c12 |
| InChI | InChI=1S/C16H21NO/c1-5-13-7-6-8-15-14(10-9-11(2)18)12(3)17(4)16(13)15/h6-8H,5,9-10H2,1-4H3 |
| InChIKey | FJPXLHAYVPNXJJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|