C14H16BrNO — CID 82502307
4-(5-bromo-1,2-dimethylindol-3-yl)butan-2-one (PubChem CID 82502307) has the molecular formula C14H16BrNO and a molecular weight of 294.19 g/mol. Its IUPAC name is 4-(5-bromo-1,2-dimethylindol-3-yl)butan-2-one.
| Compound Name | 4-(5-bromo-1,2-dimethylindol-3-yl)butan-2-one |
|---|---|
| PubChem CID | 82502307 |
| Molecular Formula | C14H16BrNO |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 4-(5-bromo-1,2-dimethylindol-3-yl)butan-2-one |
| SMILES | CC(=O)CCc1c(C)n(C)c2ccc(Br)cc12 |
| InChI | InChI=1S/C14H16BrNO/c1-9(17)4-6-12-10(2)16(3)14-7-5-11(15)8-13(12)14/h5,7-8H,4,6H2,1-3H3 |
| InChIKey | OCHVTTTXPFBPBZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|