C15H19NO3 — CID 82500817
4-(5-methoxy-1,2-dimethylindol-3-yl)butanoic acid (PubChem CID 82500817) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-(5-methoxy-1,2-dimethylindol-3-yl)butanoic acid.
| Compound Name | 4-(5-methoxy-1,2-dimethylindol-3-yl)butanoic acid |
|---|---|
| PubChem CID | 82500817 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 4-(5-methoxy-1,2-dimethylindol-3-yl)butanoic acid |
| SMILES | COc1ccc2c(c1)c(CCCC(=O)O)c(C)n2C |
| InChI | InChI=1S/C15H19NO3/c1-10-12(5-4-6-15(17)18)13-9-11(19-3)7-8-14(13)16(10)2/h7-9H,4-6H2,1-3H3,(H,17,18) |
| InChIKey | MVAHERUEOHOIGZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|