C16H23NO — CID 129194157
5-methoxy-1,2-dimethyl-3-pentylindole (PubChem CID 129194157) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 5-methoxy-1,2-dimethyl-3-pentylindole.
| Compound Name | 5-methoxy-1,2-dimethyl-3-pentylindole |
|---|---|
| PubChem CID | 129194157 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 5-methoxy-1,2-dimethyl-3-pentylindole |
| SMILES | CCCCCc1c(C)n(C)c2ccc(OC)cc12 |
| InChI | InChI=1S/C16H23NO/c1-5-6-7-8-14-12(2)17(3)16-10-9-13(18-4)11-15(14)16/h9-11H,5-8H2,1-4H3 |
| InChIKey | UENJYYPKGPWWPK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|