C15H21NO — CID 129194050
3-butyl-5-methoxy-1,2-dimethylindole (PubChem CID 129194050) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 3-butyl-5-methoxy-1,2-dimethylindole.
| Compound Name | 3-butyl-5-methoxy-1,2-dimethylindole |
|---|---|
| PubChem CID | 129194050 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 3-butyl-5-methoxy-1,2-dimethylindole |
| SMILES | CCCCc1c(C)n(C)c2ccc(OC)cc12 |
| InChI | InChI=1S/C15H21NO/c1-5-6-7-13-11(2)16(3)15-9-8-12(17-4)10-14(13)15/h8-10H,5-7H2,1-4H3 |
| InChIKey | VTYIQOLJWYSFGD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|