C16H27NO — CID 143529502
ethane;5-methoxy-1,2,3-trimethylindole (PubChem CID 143529502) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is ethane;5-methoxy-1,2,3-trimethylindole.
| Compound Name | ethane;5-methoxy-1,2,3-trimethylindole |
|---|---|
| PubChem CID | 143529502 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | ethane;5-methoxy-1,2,3-trimethylindole |
| SMILES | CC.CC.COc1ccc2c(c1)c(C)c(C)n2C |
| InChI | InChI=1S/C12H15NO.2C2H6/c1-8-9(2)13(3)12-6-5-10(14-4)7-11(8)12;2*1-2/h5-7H,1-4H3;2*1-2H3 |
| InChIKey | OLJMLROPABNIPR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|