C13H18N2O — CID 156735251
2-(4-deuterio-5-methoxy-1,2-dimethylindol-3-yl)ethanamine (PubChem CID 156735251) has the molecular formula C13H18N2O and a molecular weight of 219.31 g/mol. Its IUPAC name is 2-(4-deuterio-5-methoxy-1,2-dimethylindol-3-yl)ethanamine.
| Compound Name | 2-(4-deuterio-5-methoxy-1,2-dimethylindol-3-yl)ethanamine |
|---|---|
| PubChem CID | 156735251 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 2-(4-deuterio-5-methoxy-1,2-dimethylindol-3-yl)ethanamine |
| SMILES | [2H]c1c(OC)ccc2c1c(CCN)c(C)n2C |
| InChI | InChI=1S/C13H18N2O/c1-9-11(6-7-14)12-8-10(16-3)4-5-13(12)15(9)2/h4-5,8H,6-7,14H2,1-3H3/i8D |
| InChIKey | RXWFPSSQPBGPNU-BNEYPBHNSA-N |
| XLogP | 2.00 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|